CAS 847499-27-8
:Delanzomib
Description:
Delanzomib, with the CAS number 847499-27-8, is a small molecule inhibitor that primarily targets the proteasome, a cellular complex responsible for degrading ubiquitinated proteins. This compound is classified as a proteasome inhibitor and has been investigated for its potential therapeutic applications, particularly in the treatment of various cancers, including multiple myeloma and solid tumors. Delanzomib exhibits a unique mechanism of action by disrupting protein homeostasis within cancer cells, leading to apoptosis and inhibiting tumor growth. Its chemical structure features a specific arrangement of functional groups that contribute to its biological activity. In preclinical studies, Delanzomib has shown promise in overcoming resistance to other therapies, making it a candidate for combination treatments. However, like many investigational drugs, its safety and efficacy profiles are still under evaluation in clinical trials. Overall, Delanzomib represents a significant area of research in the field of oncology, particularly in the development of targeted therapies for malignancies.
Formula:C21H28BN3O5
InChI:InChI=1S/C21H28BN3O5/c1-13(2)12-18(22(29)30)24-21(28)19(14(3)26)25-20(27)17-11-7-10-16(23-17)15-8-5-4-6-9-15/h4-11,13-14,18-19,26,29-30H,12H2,1-3H3,(H,24,28)(H,25,27)/t14-,18+,19+/m1/s1
InChI key:InChIKey=SJFBTAPEPRWNKH-CCKFTAQKSA-N
SMILES:C(N[C@H](C(N[C@@H](CC(C)C)B(O)O)=O)[C@@H](C)O)(=O)C1=NC(=CC=C1)C2=CC=CC=C2
Synonyms:- [(1R)-1-[[(2S,3R)-3-Hydroxy-2-[[(6-phenylpyridin-2-yl)carbonyl]amino]-1-oxobutyl]amino]-3-methylbutyl]boronic acid
- B-[(1R)-1-[[(2S,3R)-3-Hydroxy-1-oxo-2-[[(6-phenyl-2-pyridinyl)carbonyl]amino]butyl]amino]-3-methylbutyl]boronic acid
- Boronic acid, [(1R)-1-[[(2S,3R)-3-hydroxy-1-oxo-2-[[(6-phenyl-2-pyridinyl)carbonyl]amino]butyl]amino]-3-methylbutyl]-
- Boronic acid, B-[(1R)-1-[[(2S,3R)-3-hydroxy-1-oxo-2-[[(6-phenyl-2-pyridinyl)carbonyl]amino]butyl]amino]-3-methylbutyl]-
- CEP 18770
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
[(1R)-1-[(2S,3R)-3-hydroxy-2-[(6-phenylpyridin-2-yl)formamido]butanamido]-3-methylbutyl]boronic acid
CAS:Formula:C21H28BN3O5Purity:97%Color and Shape:SolidMolecular weight:413.2751Delanzomib
CAS:Delanzomib (CEP-18770) is an oral proteasome inhibitor with an IC50 of 3.8 nM, targeting chymotrypsin-like activity with minimal effect on other activities.Formula:C21H28BN3O5Purity:95.52% - 99.46%Color and Shape:SolidMolecular weight:413.28Ref: TM-T6027
1mg43.00€1mL*10mM (DMSO)89.00€5mg92.00€10mg133.00€25mg260.00€50mg416.00€100mg625.00€200mg868.00€[(1R)-1-[[(2S,3R)-3-Hydroxy-2-[[(6-phenylpyridin-2-yl)carbonyl]amino]-1-oxobutyl]amino]-3-methylbutyl]boronic acid
CAS:Purity:≥97%Molecular weight:413.2799988Delanzomib
CAS:Controlled ProductStability Hygroscopic
Applications Delanzomib is an orally active proteasome inhibitor. Delanzomib has been shown to down-modulate NF-κB, induce apoptosis, inhibit angiogenesis and M-CSF-RANKL-induced osteoclastogenesis.
References Piva, R. et al.: Blood, 111, 2765 (2008); Sanchez, E. et al.: Br. J. Haematol., 148, 569 (2010);Formula:C21H28BN3O5Color and Shape:NeatMolecular weight:413.28






