CAS 847499-68-7

1-Methyl-4-piperidinebutanoic acid

Description:

1-Methyl-4-piperidinebutanoic acid, identified by its CAS number 847499-68-7, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a butanoic acid side chain, contributing to its carboxylic acid functional group, which is known for its acidic properties. The presence of the methyl group at the 1-position of the piperidine ring influences its steric and electronic properties, potentially affecting its reactivity and interaction with biological systems. Generally, compounds like this can exhibit solubility in polar solvents due to the carboxylic acid group, while the piperidine moiety may impart basic characteristics. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological conditions, given the structural similarities to other biologically active molecules. Understanding the specific characteristics, such as melting point, boiling point, and solubility, would require experimental data or literature references for precise values.

Formula: C₁₀H₁₉NO₂

InChI: InChI=1S/C10H19NO2/c1-11-7-5-9(6-8-11)3-2-4-10(12)13/h9H,2-8H2,1H3,(H,12,13)

InChI key: InChIKey=MKQQIWZZYQNYPM-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)C1CCN(C)CC1

Synonyms:

• 4-(1-Methylpiperidin-4-yl)butanoic acid
• 1-Methyl-4-piperidinebutanoic acid
• 4-Piperidinebutanoic acid, 1-methyl-