CAS 847502-81-2
:1-Bromo-3,4-difluoro-2-methylbenzene
Description:
1-Bromo-3,4-difluoro-2-methylbenzene, also known by its CAS number 847502-81-2, is an aromatic compound characterized by the presence of a bromine atom and two fluorine atoms on a methyl-substituted benzene ring. This compound features a methyl group at the 2-position, a bromine atom at the 1-position, and fluorine substituents at the 3 and 4 positions of the benzene ring, contributing to its unique reactivity and properties. The presence of halogen atoms typically enhances the compound's polarity and can influence its solubility in various solvents. Additionally, the fluorine atoms can impart stability and alter the electronic properties of the molecule, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate volatility and may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the halogens. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C7H5BrF2
InChI:InChI=1/C7H5BrF2/c1-4-5(8)2-3-6(9)7(4)10/h2-3H,1H3
SMILES:Cc1c(ccc(c1F)F)Br
Synonyms:- Benzene, 1-bromo-3,4-difluoro-2-methyl-
- 6-BROMO-2,3-DIFLUOROTOLUENE
- 2,3-Difluoro-6-bromotoluene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Bromo-2,3-difluorotoluene, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5BrF2Purity:95%Color and Shape:Liquid, Clear colorless to pale yellowMolecular weight:207.023,4-Difluoro-2-methylbromobenzene
CAS:Formula:C7H5BrF2Purity:98%Color and Shape:LiquidMolecular weight:207.0154Ref: IN-DA0034C2
250gTo inquire500gTo inquire250mg26.00€1g34.00€5g72.00€10g116.00€25g198.00€50g241.00€100g579.00€6-Bromo-2,3-difluorotoluene
CAS:6-Bromo-2,3-difluorotolueneFormula:C7H5BrF2Purity:95%Color and Shape: clear. colourless liquidMolecular weight:207.02g/mol6-Bromo-2,3-difluorotoluene
CAS:Formula:C7H5BrF2Purity:97%Color and Shape:LiquidMolecular weight:207.018




