CAS 847502-86-7

3,4-Difluoro-2-methylbenzenemethanol

Description:

3,4-Difluoro-2-methylbenzenemethanol, identified by its CAS number 847502-86-7, is an organic compound characterized by the presence of a benzene ring substituted with two fluorine atoms and a methyl group, along with a hydroxymethyl group (-CH2OH). This compound exhibits properties typical of aromatic alcohols, including potential solubility in polar solvents due to the hydroxyl group, while the fluorine substituents can influence its reactivity and polarity. The presence of fluorine atoms often enhances the compound's stability and can affect its biological activity, making it of interest in medicinal chemistry and material science. Additionally, the methyl group can introduce steric effects that may influence the compound's interactions with other molecules. Overall, 3,4-Difluoro-2-methylbenzenemethanol is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features and functional groups.

Formula: C₈H₈F₂O

InChI: InChI=1S/C8H8F2O/c1-5-6(4-11)2-3-7(9)8(5)10/h2-3,11H,4H2,1H3

InChI key: InChIKey=NTTCNPWHTYWDLK-UHFFFAOYSA-N

SMILES: C(O)C1=C(C)C(F)=C(F)C=C1

Synonyms:

• 3,4-Difluoro-2-methylbenzenemethanol
• 3,4-Difluoro-2-methylbenzyl alcohol
• (3,4-Difluoro-2-methylphenyl)methanol
• Benzenemethanol, 3,4-difluoro-2-methyl-

(3,4-Difluoro-2-methylphenyl)methanol

CAS: 847502-86-7

Formula: C₈H₈F₂O

Purity: 95%

Molecular weight: 158.1453

Ref: IN-DA01DEH3

3,4-Difluoro-2-methylbenzyl alcohol

CAS: 847502-86-7

Purity: ≥95%

Molecular weight: 158.147995

Ref: 10-F631637

(3,4-Difluoro-2-methyl-phenyl)methanol

CAS: 847502-86-7

Versatile small molecule scaffold

Formula: C₈H₈F₂O

Purity: Min. 95%

Molecular weight: 158.14 g/mol

Ref: 3D-XIB50286