CAS 847502-88-9

2,4-Difluoro-3-methylbenzaldehyde

Description:

2,4-Difluoro-3-methylbenzaldehyde is an aromatic aldehyde characterized by the presence of two fluorine atoms and a methyl group attached to a benzene ring, along with an aldehyde functional group. Its molecular structure features a benzene ring substituted at the 2 and 4 positions with fluorine atoms and at the 3 position with a methyl group, contributing to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a distinct aromatic odor. It is soluble in organic solvents and exhibits moderate stability under standard conditions. The presence of fluorine atoms enhances its reactivity and can influence its physical properties, such as boiling and melting points, compared to non-fluorinated analogs. 2,4-Difluoro-3-methylbenzaldehyde may be utilized in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₈H₆F₂O

InChI: InChI=1/C8H6F2O/c1-5-7(9)3-2-6(4-11)8(5)10/h2-4H,1H3

SMILES: Cc1c(ccc(C=O)c1F)F

Synonyms:

• Benzaldehyde, 2,4-difluoro-3-methyl-

2,4-Difluoro-3-methylbenzaldehyde

CAS: 847502-88-9

Formula: C₈H₆F₂O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 156.1294

Ref: IN-DA004S9S

2,4-Difluoro-3-methylbenzaldehyde

CAS: 847502-88-9

2,4-Difluoro-3-methylbenzaldehyde

Purity: 97%

Color and Shape: Liquid

Molecular weight: 156.13g/mol

Ref: 54-PC48740

2,4-Difluoro-3-methylbenzaldehyde

CAS: 847502-88-9

2,4-Difluoro-3-methylbenzaldehyde is a chemical compound that is used as a building block for the synthesis of other chemicals. It can be used as a research chemical or intermediate due to its versatility. 2,4-Difluoro-3-methylbenzaldehyde has a CAS number of 847502-88-9 and is classified as a speciality chemical with high quality. This compound may be useful in the synthesis of polymers and pharmaceuticals due to its ability to form covalent bonds with other molecules.

Formula: C₈H₆F₂O

Purity: Min. 95%

Color and Shape: Clear Liquid

Molecular weight: 156.13 g/mol

Ref: 3D-FD67320

2,4-Difluoro-3-methylbenzaldehyde

CAS: 847502-88-9

Formula: C₈H₆F₂O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 156.132

Ref: 10-F033814