CAS 847503-16-6
:7-Chloro-2-(3-ethoxyphenyl)-8-methyl-4-quinolinecarboxylic acid
Description:
7-Chloro-2-(3-ethoxyphenyl)-8-methyl-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro group at the 7-position and an ethoxyphenyl substituent at the 2-position, contributing to its unique chemical properties. The presence of a carboxylic acid functional group at the 4-position enhances its acidity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. The methyl group at the 8-position adds to the compound's hydrophobic characteristics. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific interactions and applications would depend on its molecular structure and the functional groups present, which can affect its pharmacokinetics and pharmacodynamics. As with many quinoline derivatives, it may also possess antimicrobial or antimalarial properties, although detailed studies would be required to confirm its efficacy and safety in biological systems.
Formula:C19H16ClNO3
InChI:InChI=1S/C19H16ClNO3/c1-3-24-13-6-4-5-12(9-13)17-10-15(19(22)23)14-7-8-16(20)11(2)18(14)21-17/h4-10H,3H2,1-2H3,(H,22,23)
InChI key:InChIKey=FLKIJAGIGMAFCI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C3=CC(OCC)=CC=C3)C(C)=C(Cl)C=C2
Synonyms:- 7-Chloro-2-(3-ethoxyphenyl)-8-methyl-4-quinolinecarboxylic acid
- 4-Quinolinecarboxylic acid, 7-chloro-2-(3-ethoxyphenyl)-8-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.