CAS 847503-17-7
:7-Chloro-2-(2,5-dimethoxyphenyl)-8-methyl-4-quinolinecarboxylic acid
Description:
7-Chloro-2-(2,5-dimethoxyphenyl)-8-methyl-4-quinolinecarboxylic acid, with the CAS number 847503-17-7, is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro substituent at the 7-position and a methoxy-substituted phenyl group at the 2-position, contributing to its unique chemical properties. The presence of a carboxylic acid functional group at the 4-position enhances its acidity and potential for hydrogen bonding, which can influence its solubility and reactivity. The compound is likely to exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential interactions with biological targets, and it may be studied for its therapeutic applications. As with many quinoline derivatives, it may also possess fluorescent properties, which can be useful in various analytical techniques. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.
Formula:C19H16ClNO4
InChI:InChI=1S/C19H16ClNO4/c1-10-15(20)6-5-12-13(19(22)23)9-16(21-18(10)12)14-8-11(24-2)4-7-17(14)25-3/h4-9H,1-3H3,(H,22,23)
InChI key:InChIKey=KJMXLJAJNHCRNO-UHFFFAOYSA-N
SMILES:O(C)C1=C(C2=NC3=C(C(C(O)=O)=C2)C=CC(Cl)=C3C)C=C(OC)C=C1
Synonyms:- 4-Quinolinecarboxylic acid, 7-chloro-2-(2,5-dimethoxyphenyl)-8-methyl-
- 7-Chloro-2-(2,5-dimethoxyphenyl)-8-methyl-4-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.