CAS 847503-23-5
:2,4-Dihydro-4-propyl-5-(4,5,6,7-tetrahydro-6-methylbenzo[b]thien-3-yl)-3H-1,2,4-triazole-3-thione
Description:
2,4-Dihydro-4-propyl-5-(4,5,6,7-tetrahydro-6-methylbenzo[b]thien-3-yl)-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its complex structure, which includes a triazole ring and a thione functional group. This compound features a propyl group and a tetrahydro-methylbenzo[b]thien moiety, contributing to its unique properties. The presence of the triazole ring suggests potential applications in pharmaceuticals, particularly in the development of antifungal or antimicrobial agents, as triazoles are known for their biological activity. The thione group may enhance its reactivity and solubility in various solvents. Additionally, the compound's structural features may influence its interaction with biological targets, making it a subject of interest in medicinal chemistry. Its CAS number, 847503-23-5, allows for easy identification and retrieval of information related to its synthesis, properties, and potential applications in scientific literature. Overall, this compound exemplifies the diverse chemistry found in heterocyclic compounds and their potential utility in various fields.
Formula:C14H19N3S2
InChI:InChI=1S/C14H19N3S2/c1-3-6-17-13(15-16-14(17)18)11-8-19-12-7-9(2)4-5-10(11)12/h8-9H,3-7H2,1-2H3,(H,16,18)
InChI key:InChIKey=DPKFXPSPPVGVIW-UHFFFAOYSA-N
SMILES:C(CC)N1C(C=2C3=C(SC2)CC(C)CC3)=NNC1=S
Synonyms:- 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-propyl-5-(4,5,6,7-tetrahydro-6-methylbenzo[b]thien-3-yl)-
- 2,4-Dihydro-4-propyl-5-(4,5,6,7-tetrahydro-6-methylbenzo[b]thien-3-yl)-3H-1,2,4-triazole-3-thione
- 3-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1H-1,2,4-triazole-5-thione
- 5-(6-METHYL-4,5,6,7-TETRAHYDRO-1-BENZOTHIEN-3-YL)-4-PROPYL-4H-1,2,4-TRIAZOLE-3-THIOL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.