CymitQuimica logo

CAS 847503-25-7

:

2,4-Dihydro-5-(2-phenyl-4-quinolinyl)-4-(2-propen-1-yl)-3H-1,2,4-triazole-3-thione

Description:
2,4-Dihydro-5-(2-phenyl-4-quinolinyl)-4-(2-propen-1-yl)-3H-1,2,4-triazole-3-thione is a synthetic organic compound characterized by its complex structure, which includes a triazole ring, a quinoline moiety, and a propenyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its unique functional groups. The presence of the triazole ring suggests possible applications in pharmaceuticals, particularly as antifungal or antimicrobial agents, as triazoles are known for their ability to inhibit specific enzymes in pathogens. Additionally, the quinoline structure may contribute to its biological activity, as quinolines are often found in various medicinal compounds. The thione functional group can also influence the compound's reactivity and stability. Overall, this compound's characteristics, including solubility, melting point, and reactivity, would depend on its specific molecular interactions and the presence of substituents, making it a subject of interest for further research in medicinal chemistry and drug development.
Formula:C20H16N4S
InChI:InChI=1S/C20H16N4S/c1-2-12-24-19(22-23-20(24)25)16-13-18(14-8-4-3-5-9-14)21-17-11-7-6-10-15(16)17/h2-11,13H,1,12H2,(H,23,25)
InChI key:InChIKey=GAAMMPVKKCDGCD-UHFFFAOYSA-N
SMILES:C(C=C)N1C(C=2C3=C(N=C(C2)C4=CC=CC=C4)C=CC=C3)=NNC1=S
Synonyms:
  • 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-5-(2-phenyl-4-quinolinyl)-4-(2-propenyl)-
  • 2,4-Dihydro-5-(2-phenyl-4-quinolinyl)-4-(2-propen-1-yl)-3H-1,2,4-triazole-3-thione
  • 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-5-(2-phenyl-4-quinolinyl)-4-(2-propen-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.