CAS 847503-26-8
:5-(4-Butoxyphenyl)-2,4-dihydro-4-methyl-3H-1,2,4-triazole-3-thione
Description:
5-(4-Butoxyphenyl)-2,4-dihydro-4-methyl-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a butoxyphenyl group, contributing to its hydrophobic properties and potential for various applications in organic synthesis and pharmaceuticals. The presence of a thione functional group (–C=S) indicates that it may exhibit specific reactivity, such as acting as a nucleophile or participating in coordination chemistry. The compound's dihydro form suggests it may exist in a stable, saturated state, which can influence its physical properties, such as solubility and melting point. Additionally, the methyl group on the triazole ring can affect the compound's steric and electronic properties, potentially enhancing its biological activity. Overall, this compound may be of interest in medicinal chemistry, particularly for its potential as a scaffold in drug development or as a bioactive agent.
Formula:C13H17N3OS
InChI:InChI=1S/C13H17N3OS/c1-3-4-9-17-11-7-5-10(6-8-11)12-14-15-13(18)16(12)2/h5-8H,3-4,9H2,1-2H3,(H,15,18)
InChI key:InChIKey=MOEFMACKNTZORW-UHFFFAOYSA-N
SMILES:CN1C(=NNC1=S)C2=CC=C(OCCCC)C=C2
Synonyms:- 5-(4-Butoxyphenyl)-2,4-dihydro-4-methyl-3H-1,2,4-triazole-3-thione
- 3H-1,2,4-Triazole-3-thione, 5-(4-butoxyphenyl)-2,4-dihydro-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.