CAS 847503-27-9
:5-(4-Butoxyphenyl)-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
Description:
5-(4-Butoxyphenyl)-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole ring structure, which contributes to its potential biological activity. The presence of the butoxyphenyl and ethyl groups enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. This compound features a thione functional group, which can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of antifungal or antibacterial agents, due to the triazole moiety's known efficacy in these areas. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 5-(4-Butoxyphenyl)-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione represents a class of compounds that may exhibit significant biological activity, warranting further investigation into its properties and potential applications in medicinal chemistry.
Formula:C14H19N3OS
InChI:InChI=1S/C14H19N3OS/c1-3-5-10-18-12-8-6-11(7-9-12)13-15-16-14(19)17(13)4-2/h6-9H,3-5,10H2,1-2H3,(H,16,19)
InChI key:InChIKey=XPEUMDNDAMUZQP-UHFFFAOYSA-N
SMILES:C(C)N1C(=NNC1=S)C2=CC=C(OCCCC)C=C2
Synonyms:- 5-(4-Butoxyphenyl)-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
- 3H-1,2,4-Triazole-3-thione, 5-(4-butoxyphenyl)-4-ethyl-2,4-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.