CAS 847560-49-0
:4-Benzyloxy-2-methylphenylboronic acid
Description:
4-Benzyloxy-2-methylphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in organic synthesis and medicinal chemistry. This compound features a phenyl ring substituted with a benzyloxy group and a methyl group, contributing to its unique reactivity and solubility properties. The boronic acid moiety allows for participation in Suzuki coupling reactions, which are vital for constructing carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, the presence of the benzyloxy group enhances the compound's stability and solubility in organic solvents. Its molecular structure and functional groups suggest potential applications in drug development and materials science, particularly in the design of sensors and catalysts. As with many boronic acids, it is important to handle this compound with care, considering its reactivity and potential environmental impact.
Formula:C14H15BO3
InChI:InChI=1/C14H15BO3/c1-11-9-13(7-8-14(11)15(16)17)18-10-12-5-3-2-4-6-12/h2-9,16-17H,10H2,1H3
Synonyms:- (4-Benzyloxy-2-methyl)benzeneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Benzyloxy-2-methylbenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C14H15BO3Purity:98%Molecular weight:242.084-Benzyloxy-2-methylphenylboronic acid
CAS:Formula:C14H15BO3Purity:97%Color and Shape:SolidMolecular weight:242.07814-(Benzyloxy)-2-methylbenzeneboronic acid
CAS:4-(Benzyloxy)-2-methylbenzeneboronic acidFormula:C14H15BO3Purity:98%Color and Shape: white solidMolecular weight:242.0781g/mol4-Benzyloxy-2-methylphenylboronic acid
CAS:Formula:C14H15BO3Purity:98%Color and Shape:SolidMolecular weight:242.08




