
CAS 84760-10-1
:2-Oxo-1-propanesulfonamide
Description:
2-Oxo-1-propanesulfonamide, also known as propanesulfonamide or sulfanilamide derivative, is an organic compound characterized by the presence of a sulfonamide functional group and a ketone. Its molecular structure features a propyl chain with a sulfonamide group (-SO2NH2) attached to a carbon that is also part of a carbonyl group (C=O). This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the sulfonamide group, which enhances its hydrophilicity. 2-Oxo-1-propanesulfonamide may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial agents. Its properties, including melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other chemical species. As with many sulfonamides, it may also participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it a versatile compound in organic synthesis.
Formula:C3H7NO3S
InChI:InChI=1S/C3H7NO3S/c1-3(5)2-8(4,6)7/h2H2,1H3,(H2,4,6,7)
InChI key:InChIKey=GTOXRTMBLGPMLH-UHFFFAOYSA-N
SMILES:C(S(N)(=O)=O)C(C)=O
Synonyms:- 2-Oxopropanesulfonamide
- 1-Propanesulfonamide, 2-oxo-
- 2-Oxo-1-propanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.