CymitQuimica logo

CAS 84761-82-0

:

2,3,8-tribromodibenzo[b,d]furan

Description:
2,3,8-Tribromodibenzo[b,d]furan is a polybrominated aromatic compound characterized by its complex structure, which consists of two fused benzene rings and a furan ring, with three bromine atoms substituted at specific positions. This compound is part of a larger class of brominated flame retardants, which are known for their effectiveness in reducing flammability in various materials. Its molecular structure contributes to its stability and persistence in the environment, raising concerns about potential bioaccumulation and toxicity. 2,3,8-Tribromodibenzo[b,d]furan is typically found in industrial applications, particularly in plastics and textiles. Due to its brominated nature, it may exhibit endocrine-disrupting properties and has been the subject of environmental monitoring and regulatory scrutiny. The compound's physical properties, such as solubility and melting point, can vary based on its molecular interactions and the presence of other substances. Overall, while it serves practical applications, its environmental and health implications necessitate careful handling and assessment.
Formula:C12H5Br3O
InChI:InChI=1/C12H5Br3O/c13-6-1-2-11-7(3-6)8-4-9(14)10(15)5-12(8)16-11/h1-5H
SMILES:c1cc2c(cc1Br)c1cc(c(cc1o2)Br)Br
Synonyms:
  • 2,3,8-Tribromo-Dibenzofuran
  • 2,3,8-Tribromodibenzofuran
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.