CymitQuimica logo

CAS 847664-64-6

:

2,5-Dichloropyridine-4-boronic acid

Description:
2,5-Dichloropyridine-4-boronic acid is an organoboron compound characterized by its pyridine ring substituted with two chlorine atoms and a boronic acid functional group. The presence of the boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. This compound typically appears as a solid and is soluble in polar solvents such as water and alcohols, owing to the boronic acid group. Its molecular structure contributes to its reactivity, particularly in the presence of nucleophiles. The chlorine substituents can influence the electronic properties of the molecule, affecting its reactivity and interaction with other chemical species. Additionally, 2,5-Dichloropyridine-4-boronic acid may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as boronic acids can be sensitive to moisture and may require specific conditions to maintain stability.
Formula:C5H4BCl2NO2
InChI:InChI=1/C5H4BCl2NO2/c7-4-2-9-5(8)1-3(4)6(10)11/h1-2,10-11H
InChI key:BEJJMDOFMZCRST-UHFFFAOYSA-N
SMILES:c1c(c(cnc1Cl)Cl)B(O)O
Synonyms:
  • (2,5-Dichloropyridin-4-yl)boronic acid
  • Boronic acid, B-(2,5-dichloro-4-pyridinyl)-
  • (2,5-Dichloro-4-Pyridyl)Boronic Acid
  • 2,5-Dichloropyridin-4-Ylboronic Acid
Found 5 products.