CAS 847664-65-7

2,5-Dichloro-4-pyridinol

Description:

2,5-Dichloro-4-pyridinol is an organic compound characterized by its pyridine ring substituted with two chlorine atoms and a hydroxyl group. It typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including agriculture and pharmaceuticals. The presence of chlorine atoms enhances its reactivity and may contribute to its biological activity. This compound is soluble in polar solvents, which can influence its behavior in different chemical environments. Its molecular structure allows for hydrogen bonding due to the hydroxyl group, which can affect its solubility and interaction with other molecules. Additionally, 2,5-Dichloro-4-pyridinol may exhibit antimicrobial properties, making it of interest in the development of pesticides or therapeutic agents. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled. Always refer to material safety data sheets (MSDS) for detailed safety and handling information.

Formula: C₅H₃Cl₂NO

InChI: InChI=1S/C5H3Cl2NO/c6-3-2-8-5(7)1-4(3)9/h1-2H,(H,8,9)

InChI key: InChIKey=RJKYZTVQNJPAGX-UHFFFAOYSA-N

SMILES: OC=1C(Cl)=CN=C(Cl)C1

Synonyms:

• 2,5-Dichloro-1H-pyridin-4-one
• 2,5-Dichloro-4-hydroxypyridine
• 2,5-Dichloro-4-pyridinol
• 4-Pyridinol, 2,5-dichloro-

2,5-dichloropyridin-4-ol

CAS: 847664-65-7

Formula: C₅H₃Cl₂NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 163.9894

Ref: IN-DA003308

2,5-Dichloro-4-hydroxypyridine

CAS: 847664-65-7

Purity: 98%

Molecular weight: 163.989

Ref: FT-D13551

2,5-Dichloro-4-hydroxypyridine

CAS: 847664-65-7

2,5-Dichloro-4-hydroxypyridine

Formula: C₅H₃Cl₂NO

Purity: ≥95%

Color and Shape: yellow powder

Molecular weight: 163.99g/mol

Ref: 54-OR5435

2,5-Dichloro-4-hydroxypyridine

CAS: 847664-65-7

2,5-Dichloro-4-hydroxypyridine is a strong oxidizing agent that can be used for the efficient synthesis of esters and peroxy esters. It can also be used to produce hydrogen peroxide from hydroxylamine and 2,5-dichloro-4-hydroxypyridine. The hydroxylation of alcohols with 2,5-dichloro-4-hydroxypyridine produces the corresponding n-oxides or peroxides in high yield. This reaction is regioselective, meaning it will only occur at one position on the molecule.

Formula: C₅H₃Cl₂NO

Purity: Min. 95%

Molecular weight: 163.99 g/mol

Ref: 3D-XIB66465