CAS 84772-16-7

3-(2,3-dimethylphenyl)-2-hydrazinoquinazolin-4(3H)-one

Description:

3-(2,3-Dimethylphenyl)-2-hydrazinoquinazolin-4(3H)-one is a chemical compound characterized by its complex structure, which includes a quinazolinone core and a hydrazino functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the hydrazine moiety, which is often linked to pharmacological effects. The dimethylphenyl substituent can influence its solubility and reactivity, making it of interest in medicinal chemistry. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Additionally, its CAS number, 84772-16-7, allows for easy reference in chemical databases. Overall, this compound's unique structure suggests potential applications in drug development or as a research tool in various chemical and biological studies.

Formula: C₁₆H₁₆N₄O

InChI: InChI=1/C16H16N4O/c1-10-6-5-9-14(11(10)2)20-15(21)12-7-3-4-8-13(12)18-16(20)19-17/h3-9H,17H2,1-2H3,(H,18,19)

SMILES: Cc1cccc(c1C)n1c(=O)c2ccccc2nc1NN

3-(2,3-Dimethylphenyl)-2-hydrazinyl-3,4-dihydroquinazolin-4-one

Controlled Product

CAS: 84772-16-7

Versatile small molecule scaffold

Formula: C₁₆H₁₆N₄O

Purity: Min. 95%

Molecular weight: 280.32 g/mol

Ref: 3D-JDA77216