CAS 847729-27-5

methyl 2-chloro-5-fluoro-pyridine-3-carboxylate

Description:

Methyl 2-chloro-5-fluoro-pyridine-3-carboxylate is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylate functional group, indicating it is an ester, specifically a methyl ester, due to the presence of a methyl group attached to the carboxylate. The chlorine and fluorine substituents at the 2 and 5 positions of the pyridine ring, respectively, contribute to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of these halogens can also influence the compound's physical properties, such as solubility and boiling point. Methyl 2-chloro-5-fluoro-pyridine-3-carboxylate may be utilized in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals, owing to its unique structural features. As with many halogenated compounds, it is essential to handle this substance with care, considering potential environmental and health impacts.

Formula: C₇H₅ClFNO₂

InChI: InChI=1/C7H5ClFNO2/c1-12-7(11)5-2-4(9)3-10-6(5)8/h2-3H,1H3

SMILES: COC(=O)c1cc(cnc1Cl)F

Synonyms:

• 3-Pyridinecarboxylic Acid, 2-Chloro-5-Fluoro-, Methyl Ester

METHYL 2-CHLORO-5-FLUORONICOTINATE

CAS: 847729-27-5

Formula: C₇H₅ClFNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 189.5715

Ref: IN-DA004XTD

Methyl 2-chloro-5-fluoronicotinate

CAS: 847729-27-5

Methyl 2-chloro-5-fluoronicotinate

Purity: 98%

Color and Shape: Low-Melting Solid

Molecular weight: 189.57g/mol

Ref: 54-PC200135

Methyl 2-chloro-5-fluoronicotinate

CAS: 847729-27-5

Formula: C₇H₅ClFNO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 189.57

Ref: 10-F324584