CymitQuimica logo

CAS 847744-15-4

:

4-Thiazolecarboxylic acid, 2-(4-ethylphenyl)-

Description:
4-Thiazolecarboxylic acid, 2-(4-ethylphenyl)-, identified by its CAS number 847744-15-4, is an organic compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 4-ethylphenyl substituent indicates that there is an ethyl group attached to a phenyl ring at the para position, which can influence the compound's solubility, stability, and biological activity. Generally, compounds like this may exhibit various properties such as moderate to high polarity due to the carboxylic acid group, and they may participate in hydrogen bonding. Additionally, thiazole derivatives are often studied for their potential pharmacological activities, including antimicrobial and anti-inflammatory effects. The specific characteristics, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable databases for precise applications in research or industry.
Formula:C12H11NO2S
InChI:InChI=1S/C12H11NO2S/c1-2-8-3-5-9(6-4-8)11-13-10(7-16-11)12(14)15/h3-7H,2H2,1H3,(H,14,15)
InChI key:InChIKey=OKIXVEUDAQRHLQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C(SC1)C2=CC=C(CC)C=C2
Synonyms:
  • 2-(4-Ethylphenyl)-1,3-thiazole-4-carboxylic acid
  • 4-Thiazolecarboxylic acid, 2-(4-ethylphenyl)-
  • 2-(4-Ethylphenyl)thiazole-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.