CymitQuimica logo

CAS 847744-16-5

:

2-(2,4-Dimethylphenyl)-4-thiazoleacetic acid

Description:
2-(2,4-Dimethylphenyl)-4-thiazoleacetic acid, identified by its CAS number 847744-16-5, is a chemical compound characterized by its thiazole and aromatic structures. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, contributing to its unique chemical properties. The presence of the 2,4-dimethylphenyl group enhances its hydrophobic characteristics and may influence its biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or analgesic agents. The carboxylic acid functional group in the structure allows for potential interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic ring and the thiazole moiety. Overall, 2-(2,4-Dimethylphenyl)-4-thiazoleacetic acid represents a class of compounds that may exhibit significant biological activity due to their structural features.
Formula:C13H13NO2S
InChI:InChI=1S/C13H13NO2S/c1-8-3-4-11(9(2)5-8)13-14-10(7-17-13)6-12(15)16/h3-5,7H,6H2,1-2H3,(H,15,16)
InChI key:InChIKey=AQDKCBABWSPBMW-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(C)=C1)C2=NC(CC(O)=O)=CS2
Synonyms:
  • 2-(2,4-Dimethylphenyl)-4-thiazoleacetic acid
  • 4-Thiazoleacetic acid, 2-(2,4-dimethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.