CymitQuimica logo

CAS 847744-28-9

:

4-(Difluoromethoxy)-3-methoxybenzenemethanamine

Description:
4-(Difluoromethoxy)-3-methoxybenzenemethanamine, with the CAS number 847744-28-9, is a chemical compound that belongs to the class of substituted anilines. This substance features a benzene ring substituted with both methoxy and difluoromethoxy groups, which contribute to its unique chemical properties. The presence of the difluoromethoxy group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The amine functional group in the structure suggests potential for hydrogen bonding, which can affect solubility and reactivity. Additionally, the compound's molecular structure may exhibit specific stereochemical configurations, impacting its interaction with biological targets. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique functional groups and structural characteristics make it a subject of interest in medicinal chemistry and material science.
Formula:C9H11F2NO2
InChI:InChI=1S/C9H11F2NO2/c1-13-8-4-6(5-12)2-3-7(8)14-9(10)11/h2-4,9H,5,12H2,1H3
InChI key:InChIKey=ZWAKVWRYSDUYIZ-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=C(OC)C=C(CN)C=C1
Synonyms:
  • Benzenemethanamine, 4-(difluoromethoxy)-3-methoxy-
  • 4-(Difluoromethoxy)-3-methoxybenzenemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.