CymitQuimica logo

CAS 847744-33-6

:

N-[(4-Fluorophenyl)sulfonyl]glycylglycine

Description:
N-[(4-Fluorophenyl)sulfonyl]glycylglycine, identified by its CAS number 847744-33-6, is a chemical compound characterized by its unique structure, which includes a glycine backbone modified with a sulfonyl group and a fluorophenyl moiety. This compound typically exhibits properties associated with both amino acids and sulfonyl compounds, such as solubility in polar solvents and potential reactivity due to the presence of the sulfonyl group. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its biological activity or reactivity. As a derivative of glycine, it may participate in various biochemical processes, making it of interest in medicinal chemistry and drug development. Its specific applications and biological activities would depend on further studies, including its interaction with biological targets and its pharmacokinetic properties. Overall, N-[(4-Fluorophenyl)sulfonyl]glycylglycine represents a compound with potential utility in research and therapeutic contexts.
Formula:C10H11FN2O5S
InChI:InChI=1S/C10H11FN2O5S/c11-7-1-3-8(4-2-7)19(17,18)13-5-9(14)12-6-10(15)16/h1-4,13H,5-6H2,(H,12,14)(H,15,16)
InChI key:InChIKey=VJGJPVSEACHTNG-UHFFFAOYSA-N
SMILES:S(NCC(NCC(O)=O)=O)(=O)(=O)C1=CC=C(F)C=C1
Synonyms:
  • N-[(4-Fluorophenyl)sulfonyl]glycylglycine
  • Glycine, N-[(4-fluorophenyl)sulfonyl]glycyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.