CAS 847759-03-9

4-[[(2-Amino-2-oxoethyl)amino]sulfonyl]benzoic acid

Description:

4-[[(2-Amino-2-oxoethyl)amino]sulfonyl]benzoic acid, identified by its CAS number 847759-03-9, is a chemical compound characterized by its sulfonamide functional group and an amino acid-like structure. This compound features a benzoic acid moiety, which contributes to its acidity and potential for forming hydrogen bonds. The presence of the sulfonyl group enhances its solubility in polar solvents, making it suitable for various biological applications. The amino group in the structure suggests potential interactions with biological targets, such as enzymes or receptors, which may be relevant in pharmaceutical contexts. Additionally, the compound's structural features may impart specific pharmacological properties, including anti-inflammatory or antimicrobial activities. Its molecular structure allows for potential modifications that could enhance its efficacy or selectivity in therapeutic applications. Overall, 4-[[(2-Amino-2-oxoethyl)amino]sulfonyl]benzoic acid represents a versatile compound with implications in medicinal chemistry and drug development.

Formula: C₉H₁₀N₂O₅S

InChI: InChI=1S/C9H10N2O5S/c10-8(12)5-11-17(15,16)7-3-1-6(2-4-7)9(13)14/h1-4,11H,5H2,(H2,10,12)(H,13,14)

InChI key: InChIKey=VRSNERLTYVAEOX-UHFFFAOYSA-N

SMILES: S(NCC(N)=O)(=O)(=O)C1=CC=C(C(O)=O)C=C1

Synonyms:

• 4-[[(2-Amino-2-oxoethyl)amino]sulfonyl]benzoic acid
• Benzoic acid, 4-[[(2-amino-2-oxoethyl)amino]sulfonyl]-

4-[(Carbamoylmethyl)sulfamoyl]benzoic acid

CAS: 847759-03-9

Versatile small molecule scaffold

Formula: C₉H₁₀N₂O₅S

Purity: Min. 95%

Molecular weight: 258.25 g/mol

Ref: 3D-XIB75903