CymitQuimica logo

CAS 847783-69-1

:

4-(2-Methylpropyl)-5-(methylthio)-4H-1,2,4-triazole-3-propanamine

Description:
4-(2-Methylpropyl)-5-(methylthio)-4H-1,2,4-triazole-3-propanamine is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a propanamine group, indicating the presence of an amine functional group, which can influence its reactivity and solubility. The presence of a methylthio group contributes to its potential as a sulfur-containing compound, which may impart specific biological activities or properties. The branched alkyl chain (2-methylpropyl) enhances its hydrophobic characteristics, potentially affecting its interaction with biological membranes and its overall pharmacokinetics. This compound may be of interest in pharmaceutical research due to its structural features, which could be linked to various biological activities, including antifungal or herbicidal properties. As with many triazole derivatives, it may also exhibit potential as a scaffold for drug development, particularly in the context of targeting specific enzymes or receptors. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H20N4S
InChI:InChI=1S/C10H20N4S/c1-8(2)7-14-9(5-4-6-11)12-13-10(14)15-3/h8H,4-7,11H2,1-3H3
InChI key:InChIKey=OZVVGHPOHUFVIR-UHFFFAOYSA-N
SMILES:C(C(C)C)N1C(CCCN)=NN=C1SC
Synonyms:
  • 4-(2-Methylpropyl)-5-(methylthio)-4H-1,2,4-triazole-3-propanamine
  • 4H-1,2,4-Triazole-3-propanamine, 4-(2-methylpropyl)-5-(methylthio)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.