CAS 847783-74-8

4-Ethyl-2,4-dihydro-5-(4-morpholinyl)-3H-1,2,4-triazole-3-thione

Description:

4-Ethyl-2,4-dihydro-5-(4-morpholinyl)-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The morpholine moiety enhances its solubility and may influence its pharmacological properties. The ethyl group provides additional steric bulk, which can affect the compound's interactions with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in agriculture or pharmaceuticals, where triazole derivatives are known for their antifungal and herbicidal properties. Its specific characteristics, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₈H₁₄N₄OS

InChI: InChI=1S/C8H14N4OS/c1-2-12-7(9-10-8(12)14)11-3-5-13-6-4-11/h2-6H2,1H3,(H,10,14)

InChI key: InChIKey=VYSYDSSGQZYSEK-UHFFFAOYSA-N

SMILES: C(C)N1C(=NNC1=S)N2CCOCC2

Synonyms:

• 4-Ethyl-2,4-dihydro-5-(4-morpholinyl)-3H-1,2,4-triazole-3-thione
• 3H-1,2,4-Triazole-3-thione, 4-ethyl-2,4-dihydro-5-(4-morpholinyl)-