CymitQuimica logo

CAS 847801-92-7

:

2-chloro-1H-pyrrolo[2,3-c]pyridine-3-carbaldehyde

Description:
2-Chloro-1H-pyrrolo[2,3-c]pyridine-3-carbaldehyde is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both a pyrrole and a pyridine ring. The presence of a chloro substituent at the 2-position and an aldehyde functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure allows for various chemical transformations, making it a valuable intermediate in the synthesis of more complex molecules. The compound's reactivity can be influenced by the electron-withdrawing nature of the chloro group and the aldehyde functionality, which can participate in nucleophilic addition reactions. Additionally, due to its structural features, it may exhibit biological activity, warranting further investigation in pharmacological studies. Overall, 2-chloro-1H-pyrrolo[2,3-c]pyridine-3-carbaldehyde is of interest in both synthetic and medicinal chemistry contexts.
Formula:C8H5ClN2O
InChI:InChI=1/C8H5ClN2O/c9-8-6(4-12)5-1-2-10-3-7(5)11-8/h1-4,11H
SMILES:c1cncc2c1c(C=O)c(Cl)[nH]2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.