CAS 847818-49-9
:4-Bromo-1-(2-methoxyethyl)-1H-pyrazole
Description:
4-Bromo-1-(2-methoxyethyl)-1H-pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. The substituent at the 1-position, a 2-methoxyethyl group, enhances its solubility and may influence its biological activity. This compound is typically a colorless to light yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it useful in synthetic chemistry and pharmaceutical applications. The presence of both bromine and methoxy groups suggests potential for diverse interactions in biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Bromo-1-(2-methoxyethyl)-1H-pyrazole is a versatile compound with potential applications in drug development and organic synthesis.
Formula:C6H9BrN2O
InChI:InChI=1S/C6H9BrN2O/c1-10-3-2-9-5-6(7)4-8-9/h4-5H,2-3H2,1H3
InChI key:InChIKey=SJIMZWZHTDHXRI-UHFFFAOYSA-N
SMILES:C(COC)N1C=C(Br)C=N1
Synonyms:- 4-Bromo-1-(2-methoxyethyl)-1H-pyrazole
- 1-(2-Methoxyethyl)-4-bromo-1H-pyrazole
- 1H-Pyrazole, 4-bromo-1-(2-methoxyethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Bromo-1-(2-methoxyethyl)-1H-pyrazole
CAS:Formula:C6H9BrN2OPurity:98%Color and Shape:LiquidMolecular weight:205.05254-Bromo-1-(2-methoxyethyl)-1H-pyrazole
CAS:4-Bromo-1-(2-methoxyethyl)-1H-pyrazolePurity:98%Molecular weight:205.05g/mol4-bromo-1-(2-methoxyethyl)-1H-pyrazole
CAS:Controlled ProductApplications 4-bromo-1-(2-methoxyethyl)-1H-pyrazole (cas# 847818-49-9) is a useful research chemical.
Formula:C6H9N2OBrColor and Shape:NeatMolecular weight:205.054-bromo-1-(2-methoxyethyl)-1H-pyrazole
CAS:4-bromo-1-(2-methoxyethyl)-1H-pyrazole is a potent and selective inhibitor of the enzyme tyrosine hydroxylase. It binds to the active site of the enzyme and inhibits its function, thereby reducing dopamine production and preventing the development of Parkinson's disease. The positioning and simulations were conducted using molecular dynamics techniques to determine the most probable binding site for this compound. The energy efficiency was calculated by comparing the free energy of activation for 4-bromo-1-(2-methoxyethyl)-1H-pyrazole with that of other inhibitors. Mathematical models have been developed to simulate how these inhibitors are able to bind to tyrosine hydroxylase in order to inhibit dopamine production. This has led to a better understanding of dyskinesia, which is a symptom of Parkinson's disease, and methods for controlling it. The profile and trajectory data were collected from an autonomous underwater vehicle (AUV)Formula:C6H9BrN2OPurity:Min. 95%Molecular weight:205.06 g/mol





