CAS 847818-55-7
:(1-Methyl-1H-pyrazol-4-yl)boronic acid
Description:
(1-Methyl-1H-pyrazol-4-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrazole ring. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents such as water and alcohols, which is a common trait for boronic acids due to their ability to form hydrogen bonds. The presence of the pyrazole moiety contributes to its potential reactivity, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The boronic acid group allows for the formation of reversible covalent bonds with diols, which is significant in biological applications, including drug design and development. Additionally, this compound may exhibit interesting biological activities, although specific biological properties would depend on the context of its use. Overall, (1-Methyl-1H-pyrazol-4-yl)boronic acid is a versatile building block in synthetic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C4H7BN2O2
InChI:InChI=1/C4H7BN2O2/c1-7-3-4(2-6-7)5(8)9/h2-3,8-9H,1H3
InChI key:InChIKey=RYGOBSYXIIUFOR-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CN(C)N=C1
Synonyms:- (1-Methyl-4-pyrazolyl)boronic acid
- (1-methyl-1H-pyrazol-4-yl)boronic acid
- 1-Methyl-1H-Pyrazol-4-Ylboronic Acid
- 1-Methyl-1H-pyrazol-4-ylboronicacid
- 1-Methyl-4-pyrazoleboronic acid
- 1-Methylpyrazole-1H-4-boronic acid
- B-(1-Methyl-1H-pyrazol-4-yl)boronic acid
- Boronic acid, (1-methyl-1H-pyrazol-4-yl)-
- Boronic acid, B-(1-methyl-1H-pyrazol-4-yl)-
- e-4-boronic Acid
- 1-Methyl-1h-pyrazol-4-yl-4-boronic acid
- 1-Methyl-1H-pyrazole-4-boronic acid xHCl
- (1-methyl-1H-pyrazol-4-yl)boro
- 4-Borono-1-methyl-1H-pyrazole
- REF DUPL: 1-Methyl-1H-pyrazole-4-boronic acid
- 1-Methyl-1H-pyrazole-4-boronic acid hydrochloride
- Boronic acid, B-(1-methyl-1H-pyrazol-4-yl)-, hydrochloride
- 1-Methyl-1H-pyrazole-4-boronic acid HCl
- (1-METHYLPYRAZOL-4-YL)BORONIC ACID
- 1-Methyl-1H-pyrazole-4-boronic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(1-Methyl-1H-pyrazol-4-yl)boronic acid
CAS:Formula:C4H7BN2O2Purity:98%Color and Shape:SolidMolecular weight:125.9216Ref: IN-DA0032SQ
250gTo inquire500gTo inquire1g25.00€5g52.00€10g76.00€25g127.00€50g183.00€100g325.00€1-Methyl-1H-pyrazole-4-boronic acid
CAS:1-Methyl-1H-pyrazole-4-boronic acidFormula:C4H7BN2O2Purity:95%Color and Shape: white solidMolecular weight:125.92158g/mol1-Methyl-1H-pyrazole-4-boronic acid
CAS:Formula:C4H7BN2O2Purity:95%Color and Shape:Solid, White to off-white powderMolecular weight:125.92(1-Methyl-1H-pyrazol-4-yl)boronic acid
CAS:(1-Methyl-1H-pyrazol-4-yl)boronic acid is a boronic acid that has been used for the synthesis of a number of heterocyclic compounds. Boronic acids are commonly used to synthesize phosphine ligands, which are reactive and can be used in cross-coupling reactions with organic halides, triflates, and tosylates. The efficiency of the reaction depends on the functional group present on the boron atom. (1-Methyl-1H-pyrazol-4-yl)boronic acid can inhibit the activity of many types of enzymes, including those involved in bacterial DNA synthesis and protein synthesis. (1-Methyl-1H-pyrazol-4-yl)boronic acid has been shown to have pharmacokinetic properties that depend on its ionization state.Formula:C4H7BN2O2Purity:Min. 95%Molecular weight:125.92 g/mol




