CAS 847818-65-9
:B-(1-Propyl-1H-pyrazol-5-yl)boronic acid
Description:
B-(1-Propyl-1H-pyrazol-5-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrazole ring. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and having a moderate melting point. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. Its pyrazole ring contributes to its biological activity, as pyrazole derivatives are known for their diverse pharmacological properties. The compound's structure includes a propyl group, which can influence its lipophilicity and overall reactivity. Additionally, B-(1-Propyl-1H-pyrazol-5-yl)boronic acid may exhibit coordination chemistry, forming complexes with transition metals, which can be useful in catalysis. Overall, this compound is significant in research and development, particularly in the fields of drug discovery and materials science.
Formula:C6H11BN2O2
InChI:InChI=1S/C6H11BN2O2/c1-2-5-9-6(7(10)11)3-4-8-9/h3-4,10-11H,2,5H2,1H3
InChI key:InChIKey=RUICPOQKVAJIFO-UHFFFAOYSA-N
SMILES:B(O)(O)C=1N(CCC)N=CC1
Synonyms:- Boronic acid, (1-propyl-1H-pyrazol-5-yl)-
- B-(1-Propyl-1H-pyrazol-5-yl)boronic acid
- 1-Propyl-1H-pyrazol-5-ylboronic acid
- (1-Propyl-1H-pyrazol-5-yl)boronic acid
- Boronic acid, B-(1-propyl-1H-pyrazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
