CAS 847837-35-8

5-(Ethylsulfonyl)-2-methylbenzoxazole

Description:

5-(Ethylsulfonyl)-2-methylbenzoxazole is an organic compound characterized by its unique structure, which includes a benzoxazole ring substituted with an ethylsulfonyl group and a methyl group. The presence of the benzoxazole moiety contributes to its potential biological activity, as benzoxazoles are known for their roles in pharmaceuticals and agrochemicals. The ethylsulfonyl group enhances the compound's solubility and may influence its reactivity and interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific formulation and purity. Additionally, the compound may possess specific optical properties due to its aromatic structure, making it of interest in various applications, including medicinal chemistry and materials science. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₁NO₃S

InChI: InChI=1S/C10H11NO3S/c1-3-15(12,13)8-4-5-10-9(6-8)11-7(2)14-10/h4-6H,3H2,1-2H3

InChI key: InChIKey=DJIFOKJAFXGMGY-UHFFFAOYSA-N

SMILES: S(CC)(=O)(=O)C=1C=C2C(=CC1)OC(C)=N2

Synonyms:

• Benzoxazole, 5-(ethylsulfonyl)-2-methyl-
• 5-(Ethylsulfonyl)-2-methylbenzoxazole

5-(Ethanesulfonyl)-2-methyl-1,3-benzoxazole

CAS: 847837-35-8

Versatile small molecule scaffold

Formula: C₁₀H₁₁NO₃S

Purity: Min. 95%

Molecular weight: 225.27 g/mol

Ref: 3D-XIB83735