CymitQuimica logo

CAS 847862-83-3

:

1,3-Benzenediol, 5-(1-hydroxyethyl)-, 1,3-diacetate

Description:
1,3-Benzenediol, 5-(1-hydroxyethyl)-, 1,3-diacetate, also known by its CAS number 847862-83-3, is an organic compound characterized by its structure, which includes a benzene ring with two hydroxyl groups and two acetate groups. This compound is a derivative of catechol, featuring a hydroxyethyl substituent at the 5-position. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and materials science. The presence of hydroxyl groups suggests that it may exhibit properties such as solubility in polar solvents and the ability to form hydrogen bonds, which can influence its reactivity and interactions with other substances. Additionally, the acetate groups can provide ester functionalities, which may enhance its stability and alter its biological activity. Overall, this compound's unique combination of functional groups makes it a subject of interest for further research and potential applications in chemical synthesis and formulation development.
Formula:C12H14O5
InChI:InChI=1S/C12H14O5/c1-7(13)10-4-11(16-8(2)14)6-12(5-10)17-9(3)15/h4-7,13H,1-3H3
InChI key:InChIKey=YVKHJEUIXBRIKR-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1=CC(C(C)O)=CC(OC(C)=O)=C1
Synonyms:
  • 1-(3,5-Diacetoxyphenyl)-1-ethanol
  • 1,3-Benzenediol, 5-(1-hydroxyethyl)-, 1,3-diacetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.