CAS 847872-11-1

Phenol, 4-amino-3-bromo-5-fluoro-

Description:

Phenol, 4-amino-3-bromo-5-fluoro- is an organic compound characterized by the presence of a phenolic hydroxyl group (-OH) attached to a benzene ring, along with amino (-NH2), bromo (-Br), and fluoro (-F) substituents. This compound features a complex structure that influences its chemical reactivity and physical properties. The amino group can participate in hydrogen bonding, enhancing solubility in polar solvents, while the halogen substituents (bromo and fluoro) can affect the compound's reactivity, stability, and potential biological activity. The presence of these halogens typically increases the lipophilicity of the molecule, which can influence its interaction with biological systems. Additionally, the compound may exhibit unique spectral properties, making it useful in various applications, including pharmaceuticals and agrochemicals. Its specific reactivity and applications would depend on the context of its use, including potential roles in synthesis or as an intermediate in chemical reactions. Safety and handling considerations are essential due to the presence of halogens and the potential for biological activity.

Formula: C₆H₅BrFNO

InChI: InChI=1S/C6H5BrFNO/c7-4-1-3(10)2-5(8)6(4)9/h1-2,10H,9H2

InChI key: InChIKey=DOPYFZKJWNMJKQ-UHFFFAOYSA-N

SMILES: NC1=C(Br)C=C(O)C=C1F

Synonyms:

• Phenol, 4-amino-3-bromo-5-fluoro-
• 4-Amino-3-bromo-5-fluorophenol