CAS 84788-92-1
:Isatin
Description:
Isatin, with the CAS number 84788-92-1, is an organic compound that belongs to the class of indole derivatives. It is characterized by a bicyclic structure that includes a fused benzene and pyrrole ring, with a carbonyl group (C=O) and an amine group (NH) at the 1 and 2 positions, respectively. Isatin is typically a yellow to orange crystalline solid that is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. It exhibits a range of biological activities, including antimicrobial, anti-inflammatory, and anticancer properties, making it of interest in medicinal chemistry. Isatin can undergo various chemical reactions, such as oxidation and substitution, allowing for the synthesis of numerous derivatives with potentially enhanced pharmacological effects. Additionally, it serves as a precursor in the synthesis of dyes and other organic compounds. Its unique structure and reactivity make isatin a valuable compound in both research and industrial applications.
Formula:C8H5NO2
InChI:InChI=1S/C8H5NO2/c10-7-5-3-1-2-4-6(5)9-8(7)11/h1-4H,(H,9,10,11)
InChI key:InChIKey=JXDYKVIHCLTXOP-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC1=O)=CC=CC2
Synonyms:- 2,3-Diketoindoline
- o-Aminobenzoylformic anhydride
- 1H-Indole-2,3-dione
- 2,3-Dioxoindoline
- Indole-2,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.