
CAS 847899-43-8
:3,3′-Bi-7-oxabicyclo[4.1.0]heptane, homopolymer
Description:
3,3′-Bi-7-oxabicyclo[4.1.0]heptane, homopolymer, identified by CAS number 847899-43-8, is a synthetic polymer characterized by its unique bicyclic structure that incorporates oxygen atoms within its framework. This polymer exhibits properties typical of polyethers, such as good thermal stability, chemical resistance, and flexibility. The presence of the bicyclic system contributes to its rigidity and potential for forming crystalline regions, which can enhance its mechanical strength. Additionally, the polymer may demonstrate interesting solubility characteristics depending on its molecular weight and the presence of functional groups. Its applications could span various fields, including materials science and engineering, where it may be utilized in coatings, adhesives, or as a component in composite materials. The specific properties, such as melting point, glass transition temperature, and tensile strength, would depend on the polymer's molecular weight and processing conditions. Overall, this polymer represents a versatile material with potential for innovative applications in advanced technologies.
Formula:(C12H18O2)x
InChI:InChI=1S/C12H18O2/c1-3-9-11(13-9)5-7(1)8-2-4-10-12(6-8)14-10/h7-12H,1-6H2
InChI key:InChIKey=CFXPUPHOOWUQRH-UHFFFAOYSA-N
SMILES:C12C(O1)CCC(C2)C3CC4C(CC3)O4
Synonyms:- 3,3′-Bi-7-oxabicyclo[4.1.0]heptane, homopolymer
- E-BP (epoxy resin)
- Bicyclohexyl-3,3′-dioxide homopolymer
- CEL 8000
- E-BP
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
