CAS 847900-55-4

4,7-Dichloroimidazo[1,5-a]quinoxaline

Description:

4,7-Dichloroimidazo[1,5-a]quinoxaline is a heterocyclic compound characterized by its fused imidazole and quinoxaline rings, which contribute to its unique chemical properties. This compound features two chlorine atoms at the 4 and 7 positions of the imidazo ring, enhancing its reactivity and potential biological activity. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents, while being less soluble in water due to its aromatic structure. The presence of chlorine substituents can influence its electronic properties, making it a candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure allows for potential interactions with biological targets, which may lead to antimicrobial or anticancer activities. Additionally, the compound's stability and reactivity can be affected by environmental conditions, such as pH and temperature. Overall, 4,7-Dichloroimidazo[1,5-a]quinoxaline is of interest in research for its potential therapeutic applications and its role in the synthesis of other complex organic molecules.

Formula: C₁₀H₅Cl₂N₃

InChI: InChI=1S/C10H5Cl2N3/c11-6-1-2-8-7(3-6)14-10(12)9-4-13-5-15(8)9/h1-5H

InChI key: InChIKey=RNXRNWDVRHNIOQ-UHFFFAOYSA-N

SMILES: ClC=1C=2N(C=3C(N1)=CC(Cl)=CC3)C=NC2

Synonyms:

• Imidazo[1,5-a]quinoxaline, 4,7-dichloro-
• 4,7-Dichloroimidazo[1,5-a]quinoxaline

4,7-Dichloroimidazo[1,5-a]quinoxaline

CAS: 847900-55-4

Versatile small molecule scaffold

Formula: C₁₀H₅Cl₂N₃

Purity: Min. 95%

Molecular weight: 238.07 g/mol

Ref: 3D-XIB90055