CAS 847900-74-7: 7-Bromo-2-chloro-4-(trifluoromethyl)quinoline

Description: 7-Bromo-2-chloro-4-(trifluoromethyl)quinoline is a heterocyclic organic compound characterized by its quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 7 and 2 positions, respectively, along with a trifluoromethyl group at the 4 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its trifluoromethyl group enhances lipophilicity and can influence biological activity, making it of interest in medicinal chemistry and material science. The bromine and chlorine atoms can also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the compound may exhibit specific spectral characteristics in techniques like NMR and IR spectroscopy, aiding in its identification and analysis. Overall, 7-Bromo-2-chloro-4-(trifluoromethyl)quinoline is a versatile compound with potential applications in pharmaceuticals and agrochemicals.

Formula: C₁₀H₄BrClF₃N

InChI: InChI=1S/C10H4BrClF3N/c11-5-1-2-6-7(10(13,14)15)4-9(12)16-8(6)3-5/h1-4H

InChI key: InChIKey=YOIHZSGFGHVKGW-UHFFFAOYSA-N

SMILES: FC(F)(F)C=1C=C(Cl)N=C2C=C(Br)C=CC21

Synonyms:

• Quinoline, 7-bromo-2-chloro-4-(trifluoromethyl)-
• 7-Bromo-2-chloro-4-(trifluoromethyl)quinoline

7-Bromo-2-chloro-4-(trifluoromethyl)quinoline

CAS: 847900-74-7

• Molecular weight: 310.50g/mol

7-Bromo-2-chloro-4-(trifluoromethyl)quinoline

CAS: 847900-74-7

• Purity: NULL
• Molecular weight: 310.5