CAS 847906-32-5

5,7-Dimethyl-1H-indazole-3-carbonitrile

Description:

5,7-Dimethyl-1H-indazole-3-carbonitrile is a chemical compound characterized by its indazole core, which features a five-membered ring containing two nitrogen atoms. The presence of methyl groups at the 5 and 7 positions contributes to its structural complexity and can influence its chemical reactivity and physical properties. The carbonitrile functional group at the 3 position introduces a polar character, enhancing its solubility in polar solvents. This compound is typically used in medicinal chemistry and may exhibit biological activity, making it of interest for pharmaceutical research. Its molecular structure allows for potential interactions with various biological targets, which can be explored in drug development. Additionally, the compound's stability, reactivity, and potential applications can be influenced by the specific arrangement of its substituents. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the carbonitrile group, which can be toxic. Overall, 5,7-Dimethyl-1H-indazole-3-carbonitrile represents a versatile scaffold in organic synthesis and medicinal chemistry.

Formula: C₁₀H₉N₃

InChI: InChI=1S/C10H9N3/c1-6-3-7(2)10-8(4-6)9(5-11)12-13-10/h3-4H,1-2H3,(H,12,13)

InChI key: InChIKey=LNTUKRXOERVQEC-UHFFFAOYSA-N

SMILES: C(#N)C=1C=2C(=C(C)C=C(C)C2)NN1

Synonyms:

• 1H-Indazole-3-carbonitrile, 5,7-dimethyl-
• 5,7-Dimethyl-1H-indazole-3-carbonitrile