CAS 84794-72-9

2,2'-[(2-chlorobenzene-1,4-diyl)bis(oxy)]diacetic acid

Description:

2,2'-[(2-chlorobenzene-1,4-diyl)bis(oxy)]diacetic acid, with the CAS number 84794-72-9, is an organic compound characterized by its structure, which features a bis(ether) linkage and two carboxylic acid functional groups. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid groups. The chlorobenzene moiety contributes to its aromatic character, potentially influencing its reactivity and interactions with other chemical species. The presence of the ether linkages may enhance its stability and solubility in various environments. As a diacid, it can participate in acid-base reactions and may form salts or esters with appropriate bases or alcohols. Its unique structure suggests potential applications in fields such as pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate any associated risks.

Formula: C₁₀H₉ClO₆

InChI: InChI=1/C10H9ClO6/c11-7-3-6(16-4-9(12)13)1-2-8(7)17-5-10(14)15/h1-3H,4-5H2,(H,12,13)(H,14,15)

SMILES: c1cc(c(cc1OCC(=O)O)Cl)OCC(=O)O

Synonyms:

• Acetic Acid, 2,2'-[(2-Chloro-1,4-Phenylene)Bis(Oxy)]Bis-
• 2-[4-(carboxymethoxy)-2-chloro-phenoxy]acetic acid
• Acetic acid, 2,2'-[(2-chloro-1,4-phenylene)bis(oxy)]bis- (9CI)