CAS 847947-33-5

2,6-Bis(trifluoromethyl)-4H-pyran-4-one

Description:

2,6-Bis(trifluoromethyl)-4H-pyran-4-one is a synthetic organic compound characterized by its unique pyranone structure, which features a six-membered ring containing both oxygen and carbon atoms. The presence of two trifluoromethyl groups at the 2 and 6 positions significantly influences its chemical properties, enhancing its lipophilicity and stability. This compound is typically a solid at room temperature and exhibits a pale yellow to white appearance. It is known for its potential applications in medicinal chemistry and materials science, particularly due to its reactivity and ability to participate in various chemical transformations. The trifluoromethyl groups contribute to its electron-withdrawing characteristics, which can affect its reactivity in nucleophilic substitution reactions. Additionally, 2,6-Bis(trifluoromethyl)-4H-pyran-4-one may exhibit interesting biological activities, making it a subject of research in drug development. As with many fluorinated compounds, it is essential to handle it with care, considering its potential environmental and health impacts.

Formula: C₇H₂F₆O₂

InChI: InChI=1S/C7H2F6O2/c8-6(9,10)4-1-3(14)2-5(15-4)7(11,12)13/h1-2H

InChI key: InChIKey=PZJUNGWKZOMUKS-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1OC(C(F)(F)F)=CC(=O)C1

Synonyms:

• 4H-Pyran-4-one, 2,6-bis(trifluoromethyl)-
• 2,6-Bis(trifluoromethyl)-4H-pyran-4-one

2,6-Bis(trifluoromethyl)-4H-pyran-4-one

CAS: 847947-33-5

2,6-Bis(trifluoromethyl)-4H-pyran-4-one

Purity: ≥95%

Molecular weight: 232.08g/mol

Ref: 54-PC408198