CAS 847951-47-7

3-(2,6-dimethoxyphenyl)-3-oxo-propanenitrile

Description:

3-(2,6-Dimethoxyphenyl)-3-oxo-propanenitrile, with the CAS number 847951-47-7, is an organic compound characterized by its unique structure that includes a nitrile functional group and a ketone. The presence of the 2,6-dimethoxyphenyl group contributes to its aromatic properties, enhancing its stability and potential reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic structure. The nitrile group (-C≡N) is known for its ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions, making this compound potentially useful in synthetic organic chemistry. Additionally, the methoxy groups (-OCH3) can influence the electronic properties of the molecule, affecting its reactivity and interaction with other chemical species. Overall, 3-(2,6-dimethoxyphenyl)-3-oxo-propanenitrile is of interest for its potential applications in pharmaceuticals and materials science, although specific applications would depend on further research and development.

Formula: C₁₁H₁₁NO₃

InChI: InChI=1/C11H11NO3/c1-14-9-4-3-5-10(15-2)11(9)8(13)6-7-12/h3-5H,6H2,1-2H3

SMILES: COc1cccc(c1C(=O)CC#N)OC

Synonyms:

• 3-(2,6-Dimethoxyphenyl)-3-oxopropanenitrile
• Benzenepropanenitrile, 2,6-Dimethoxy-Β-Oxo-