CAS 847956-15-4

4-(3-Thienyl)-2-thiazolecarboxylic acid

Description:

4-(3-Thienyl)-2-thiazolecarboxylic acid is an organic compound characterized by its unique structural features, which include a thiazole ring and a thiophene moiety. The thiazole ring contributes to its heterocyclic nature, while the presence of the carboxylic acid functional group (-COOH) imparts acidic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure suggests potential applications in pharmaceuticals and agrochemicals, particularly due to the biological activity often associated with thiazole and thiophene derivatives. The compound may also participate in various chemical reactions, such as esterification or amidation, owing to its functional groups. Additionally, it may exhibit interesting electronic properties due to the conjugation between the thiazole and thiophene rings, which can influence its reactivity and interaction with biological targets. Overall, 4-(3-Thienyl)-2-thiazolecarboxylic acid is a compound of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₈H₅NO₂S₂

InChI: InChI=1S/C8H5NO2S2/c10-8(11)7-9-6(4-13-7)5-1-2-12-3-5/h1-4H,(H,10,11)

InChI key: InChIKey=XWDJFILHNHMMPP-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NC(=CS1)C=2C=CSC2

Synonyms:

• 4-(3-Thienyl)-2-thiazolecarboxylic acid
• 2-Thiazolecarboxylic acid, 4-(3-thienyl)-