CymitQuimica logo

CAS 84797-54-6

:

N-(2-chloroethyl)-1H-benzimidazol-2-amine

Description:
N-(2-chloroethyl)-1H-benzimidazol-2-amine is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a chloroethyl group, which enhances its reactivity and potential for biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chloroethyl moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets. The compound's structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its properties may include moderate to high stability under standard conditions, but it could be sensitive to hydrolysis or other reactions in the presence of nucleophiles. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactivity and potential toxicity.
Formula:C9H10ClN3
InChI:InChI=1/C9H10ClN3/c10-5-6-11-9-12-7-3-1-2-4-8(7)13-9/h1-4H,5-6H2,(H2,11,12,13)
SMILES:c1ccc2c(c1)[nH]c(=NCCCl)[nH]2
Synonyms:
  • 1H-benzimidazol-2-amine, N-(2-chloroethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.