CAS 847997-88-0

2H-1,2,4-Benzothiadiazine, 6-chloro-3-(chloromethyl)-3,4-dihydro-, 1,1-dioxide

Description:

2H-1,2,4-Benzothiadiazine, 6-chloro-3-(chloromethyl)-3,4-dihydro-, 1,1-dioxide, commonly referred to by its CAS number 847997-88-0, is a chemical compound characterized by its unique bicyclic structure that incorporates both a benzothiadiazine and a sulfonyl group. This compound typically exhibits properties such as moderate solubility in polar solvents and stability under standard laboratory conditions. Its structure includes a chlorine atom and a chloromethyl group, which can influence its reactivity and potential applications in various chemical reactions. The presence of the sulfonyl group (1,1-dioxide) suggests potential for interactions with nucleophiles, making it a candidate for further chemical modifications. This compound may be of interest in pharmaceutical research, particularly in the development of biologically active molecules, due to its structural features that can interact with biological targets. As with many chemical substances, safety precautions should be observed when handling it, and its environmental impact should be assessed in accordance with regulatory guidelines.

Formula: C₈H₈Cl₂N₂O₂S

InChI: InChI=1S/C8H8Cl2N2O2S/c9-4-8-11-6-3-5(10)1-2-7(6)15(13,14)12-8/h1-3,8,11-12H,4H2

InChI key: InChIKey=OSYCZTIVGAQZCW-UHFFFAOYSA-N

SMILES: O=S1(=O)C=2C(NC(CCl)N1)=CC(Cl)=CC2

Synonyms:

• 2H-1,2,4-Benzothiadiazine, 6-chloro-3-(chloromethyl)-3,4-dihydro-, 1,1-dioxide