CAS 84803-62-3

N,N-Dimethyl-2-(propylamino)butanamide

Description:

N,N-Dimethyl-2-(propylamino)butanamide, with the CAS number 84803-62-3, is an organic compound characterized by its amide functional group, which is derived from butanoic acid. This substance features a butanamide backbone with two methyl groups attached to the nitrogen atom, along with a propylamino substituent. The presence of these functional groups contributes to its potential as a polar molecule, influencing its solubility in various solvents. Typically, compounds like this may exhibit moderate to high boiling points due to the presence of hydrogen bonding capabilities associated with the amide group. Additionally, the structure suggests potential applications in pharmaceuticals or as a chemical intermediate, given the presence of both amine and amide functionalities, which can participate in various chemical reactions. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is placed. Safety data and handling precautions should be consulted due to the potential biological activity of amide-containing compounds.

Formula: C₉H₂₀N₂O

InChI: InChI=1/C9H20N2O/c1-5-7-10-8(6-2)9(12)11(3)4/h8,10H,5-7H2,1-4H3

InChI key: InChIKey=ZTQZPLOALMHVJS-UHFFFAOYSA-N

SMILES: C(C(N(C)C)=O)(NCCC)CC

Synonyms:

• Butanamide, N,N-dimethyl-2-(propylamino)-
• Butyramide, N,N-dimethyl-2-propylamino-
• N,N-dimethyl-2-(propylamino)butanamide
• N,N-Dimethyl-2-(propylamino)butyramide
• Einecs 284-189-7

N,N-Dimethyl-2-propylaminobutyramide

Controlled Product

CAS: 84803-62-3

Formula: C₉H₂₀N₂O

Color and Shape: Neat

Molecular weight: 172.268

Ref: TR-D465860