CAS 84803-66-7

Cyclopentaneethanesulfonic acid, α-hydroxy-, sodium salt (1:1)

Description:

Cyclopentaneethanesulfonic acid, α-hydroxy-, sodium salt (1:1), commonly referred to as a sulfonic acid derivative, is characterized by its sulfonate group, which imparts strong acidic properties. This compound features a cyclopentane ring and an ethane backbone, with an α-hydroxy group that enhances its reactivity and solubility in water. As a sodium salt, it is typically more soluble in aqueous solutions compared to its acid form, making it useful in various applications, including as a buffering agent or in biochemical assays. The presence of the sulfonic acid group contributes to its ability to interact with proteins and other biomolecules, which can be advantageous in pharmaceutical and biochemical contexts. Additionally, this compound is likely to exhibit good thermal stability and may have low volatility, making it suitable for use in various chemical processes. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₁₄O₄S·Na

InChI: InChI=1S/C7H14O4S.Na/c8-7(12(9,10)11)5-6-3-1-2-4-6;/h6-8H,1-5H2,(H,9,10,11);

InChI key: InChIKey=NTPVNURSAKZWPP-UHFFFAOYSA-N

SMILES: C(S(=O)(=O)O)(CC1CCCC1)O.[Na]

Synonyms:

• Cyclopentaneethanesulfonic acid, α-hydroxy-, sodium salt (1:1)
• Cyclopentaneethanesulfonic acid, α-hydroxy-, monosodium salt