
CAS 84803-73-6
:1,5-Diethyl 2,4-diacetyl-3-(4-chlorophenyl)pentanedioate
Description:
1,5-Diethyl 2,4-diacetyl-3-(4-chlorophenyl)pentanedioate, with the CAS number 84803-73-6, is an organic compound characterized by its complex structure, which includes multiple functional groups such as esters and ketones. This compound features a pentanedioate backbone, indicating the presence of two carboxylate groups, which are esterified with ethyl groups. The presence of acetyl groups at the 2 and 4 positions contributes to its reactivity and potential applications in organic synthesis. Additionally, the 4-chlorophenyl substituent enhances its chemical properties, potentially influencing its solubility and reactivity. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis typically involves multi-step organic reactions, and it may be used as an intermediate in the production of more complex molecules. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound exemplifies the diversity of organic chemistry and its applications in various fields.
Formula:C19H23ClO6
InChI:InChI=1S/C19H23ClO6/c1-5-25-18(23)15(11(3)21)17(13-7-9-14(20)10-8-13)16(12(4)22)19(24)26-6-2/h7-10,15-17H,5-6H2,1-4H3
InChI key:InChIKey=DNQLYCOOQIWASI-UHFFFAOYSA-N
SMILES:C(C(C(OCC)=O)C(C)=O)(C(C(OCC)=O)C(C)=O)C1=CC=C(Cl)C=C1
Synonyms:- Pentanedioic acid, 2,4-diacetyl-3-(4-chlorophenyl)-, 1,5-diethyl ester
- Pentanedioic acid, 2,4-diacetyl-3-(4-chlorophenyl)-, diethyl ester
- 1,5-Diethyl 2,4-diacetyl-3-(4-chlorophenyl)pentanedioate
- 2,4-Diacetyl-3-(4-chloro-phenyl)-pentanedioic acid diethyl ester
- Glutaric acid, 2,4-diacetyl-3-(p-chlorophenyl)-, diethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

