CAS 848068-69-9

1-[4-(1H-1,2,4-triazol-1-yl)phenyl]ethanamine

Description:

1-[4-(1H-1,2,4-triazol-1-yl)phenyl]ethanamine, with the CAS number 848068-69-9, is an organic compound characterized by its unique structure that includes a triazole ring and an ethanamine moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of both aromatic and amine functional groups. It may display biological activity, particularly in pharmaceutical applications, as triazole derivatives are often investigated for their potential as antifungal agents or in other therapeutic contexts. The presence of the triazole ring contributes to its ability to form hydrogen bonds, which can enhance its interactions with biological targets. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic ring and the amine group, making it a subject of interest in medicinal chemistry. Overall, this compound's characteristics make it a valuable candidate for further research in drug development and related fields.

Formula: C₁₀H₁₂N₄

InChI: InChI=1/C10H12N4/c1-8(11)9-2-4-10(5-3-9)14-7-12-6-13-14/h2-8H,11H2,1H3

SMILES: CC(c1ccc(cc1)n1cncn1)N

Synonyms:

• benzenemethanamine, alpha-methyl-4-(1H-1,2,4-triazol-1-yl)-

(1-[4-(1H-1,2,4-Triazol-1-yl)phenyl]ethyl)amine hydrochloride

CAS: 848068-69-9

Formula: C₁₀H₁₂N₄

Molecular weight: 188.2291

Ref: IN-DA004QXR