CymitQuimica logo

CAS 848080-31-9

:

N-(1-ethyl-3,4-dihydro-2H-quinolin-7-yl)-1,1,1-trifluoro-methanesulfonamide

Description:
N-(1-ethyl-3,4-dihydro-2H-quinolin-7-yl)-1,1,1-trifluoro-methanesulfonamide, with CAS number 848080-31-9, is a chemical compound characterized by its unique structure that includes a quinoline moiety and a trifluoromethanesulfonamide functional group. This compound typically exhibits properties associated with both the quinoline and sulfonamide classes, such as potential biological activity and solubility in polar solvents. The presence of trifluoromethyl groups often enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. It may also exhibit specific pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are critical for its potential applications in drug development. As with many sulfonamides, it may also possess antibacterial or antiviral properties, although specific biological activities would need to be confirmed through empirical studies. Overall, this compound represents a blend of organic chemistry and pharmacology, with potential implications in therapeutic applications.
Formula:C12H15F3N2O2S
InChI:InChI=1/C12H15F3N2O2S/c1-2-17-7-3-4-9-5-6-10(8-11(9)17)16-20(18,19)12(13,14)15/h5-6,8,16H,2-4,7H2,1H3
SMILES:CCN1CCCc2ccc(cc12)NS(=O)(=O)C(F)(F)F
Synonyms:
  • Methanesulfonamide, N-(1-ethyl-1,2,3,4-tetrahydro-7-quinolinyl)-1,1,1-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.