CAS 848080-35-3
:1,1,1-trifluoro-N-(1-isobutyl-3,4-dihydro-2H-quinolin-7-yl)methanesulfonamide
Description:
1,1,1-Trifluoro-N-(1-isobutyl-3,4-dihydro-2H-quinolin-7-yl)methanesulfonamide, with CAS number 848080-35-3, is a chemical compound characterized by its unique trifluoromethyl and sulfonamide functional groups. This compound features a quinoline moiety, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the trifluoromethyl group enhances lipophilicity and metabolic stability, making it an interesting candidate for pharmaceutical applications. The isobutyl substituent provides steric bulk, which can influence the compound's interaction with biological targets. Additionally, the sulfonamide group is known for its role in various therapeutic agents, often contributing to antibacterial and diuretic properties. The compound's structure suggests potential for diverse interactions in biological systems, making it a subject of interest in drug discovery and development. Its physical properties, such as solubility and stability, would depend on the specific conditions, including pH and solvent environment, which are crucial for understanding its behavior in biological and chemical contexts.
Formula:C14H19F3N2O2S
InChI:InChI=1/C14H19F3N2O2S/c1-10(2)9-19-7-3-4-11-5-6-12(8-13(11)19)18-22(20,21)14(15,16)17/h5-6,8,10,18H,3-4,7,9H2,1-2H3
SMILES:CC(C)CN1CCCc2ccc(cc12)NS(=O)(=O)C(F)(F)F
Synonyms:- 1,1,1-Trifluoro-N-[1,2,3,4-tetrahydro-1-(2-methylpropyl)-7-quinolinyl]methanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1,1-Trifluoro-N-(1-isobutyl-1,2,3,4-tetrahydroquinolin-7-yl)methanesulfonamide
CAS:Formula:C14H19F3N2O2SMolecular weight:336.3731
