
CAS 84812-04-4
:2-[(2-Propen-1-yloxy)methyl]-1,4,7,10,13,16-hexaoxacyclooctadecane
Description:
2-[(2-Propen-1-yloxy)methyl]-1,4,7,10,13,16-hexaoxacyclooctadecane, commonly referred to by its CAS number 84812-04-4, is a synthetic compound characterized by its unique structure that includes a cyclic ether framework and an allyl ether functional group. This compound features a hexaoxacyclooctadecane backbone, which consists of multiple ether linkages, contributing to its potential solubility in polar solvents and its stability under various conditions. The presence of the propenyloxy group introduces reactivity, allowing for potential polymerization or cross-linking reactions, making it useful in applications such as adhesives, coatings, or as a surfactant. Its molecular structure suggests that it may exhibit properties such as low volatility and moderate thermal stability. Additionally, the compound's design may impart biocompatibility, making it of interest in biomedical applications. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C16H30O7
InChI:InChI=1S/C16H30O7/c1-2-3-21-14-16-15-22-11-10-19-7-6-17-4-5-18-8-9-20-12-13-23-16/h2,16H,1,3-15H2
InChI key:InChIKey=PVEMXXSASUDFKJ-UHFFFAOYSA-N
SMILES:C(OCC=C)C1COCCOCCOCCOCCOCCO1
Synonyms:- 1,4,7,10,13,16-Hexaoxacyclooctadecane, 2-[(2-propenyloxy)methyl]-
- 2-(Allyloxymethyl)-18-crown 6-ether
- (Allyloxy)methyl-18-crown-6
- 2-[(2-Propen-1-yloxy)methyl]-1,4,7,10,13,16-hexaoxacyclooctadecane
- 1,4,7,10,13,16-Hexaoxacyclooctadecane, 2-[(2-propen-1-yloxy)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
